C15H18Br2O4 — CID 23749492
(E,7S)-7-(3,5-dibromo-2-hydroxyphenyl)-7-hydroxy-6,6-dimethylhept-2-enoic acid (PubChem CID 23749492) has the molecular formula C15H18Br2O4 and a molecular weight of 422.11 g/mol. Its IUPAC name is (E,7S)-7-(3,5-dibromo-2-hydroxyphenyl)-7-hydroxy-6,6-dimethylhept-2-enoic acid.
| Compound Name | (E,7S)-7-(3,5-dibromo-2-hydroxyphenyl)-7-hydroxy-6,6-dimethylhept-2-enoic acid |
|---|---|
| PubChem CID | 23749492 |
| Molecular Formula | C15H18Br2O4 |
| Molecular Weight | 422.11 g/mol |
| Exact Mass | 419.96 |
| IUPAC Name | (E,7S)-7-(3,5-dibromo-2-hydroxyphenyl)-7-hydroxy-6,6-dimethylhept-2-enoic acid |
| SMILES | CC(C)(CC/C=C/C(=O)O)[C@H](O)c1cc(Br)cc(Br)c1O |
| InChI | InChI=1S/C15H18Br2O4/c1-15(2,6-4-3-5-12(18)19)14(21)10-7-9(16)8-11(17)13(10)20/h3,5,7-8,14,20-21H,4,6H2,1-2H3,(H,18,19)/b5-3+/t14-/m1/s1 |
| InChIKey | VXBBIJITJNJOGX-LYKUJDHUSA-N |
| XLogP | 4.40 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.11 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|