C13H14Br2O4 — CID 23749496
(E,5R)-5-(3,5-dibromo-2-hydroxyphenyl)-5-hydroxy-4,4-dimethylpent-2-enoic acid (PubChem CID 23749496) has the molecular formula C13H14Br2O4 and a molecular weight of 394.06 g/mol. Its IUPAC name is (E,5R)-5-(3,5-dibromo-2-hydroxyphenyl)-5-hydroxy-4,4-dimethylpent-2-enoic acid.
| Compound Name | (E,5R)-5-(3,5-dibromo-2-hydroxyphenyl)-5-hydroxy-4,4-dimethylpent-2-enoic acid |
|---|---|
| PubChem CID | 23749496 |
| Molecular Formula | C13H14Br2O4 |
| Molecular Weight | 394.06 g/mol |
| Exact Mass | 391.93 |
| IUPAC Name | (E,5R)-5-(3,5-dibromo-2-hydroxyphenyl)-5-hydroxy-4,4-dimethylpent-2-enoic acid |
| SMILES | CC(C)(/C=C/C(=O)O)[C@@H](O)c1cc(Br)cc(Br)c1O |
| InChI | InChI=1S/C13H14Br2O4/c1-13(2,4-3-10(16)17)12(19)8-5-7(14)6-9(15)11(8)18/h3-6,12,18-19H,1-2H3,(H,16,17)/b4-3+/t12-/m0/s1 |
| InChIKey | VQTKRNLAOLAHDP-PCAWENJQSA-N |
| XLogP | 3.62 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.06 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|