C14H17BrO4 — CID 23749502
(E,6S,7S)-7-(5-bromo-2-hydroxyphenyl)-7-hydroxy-6-methylhept-2-enoic acid (PubChem CID 23749502) has the molecular formula C14H17BrO4 and a molecular weight of 329.19 g/mol. Its IUPAC name is (E,6S,7S)-7-(5-bromo-2-hydroxyphenyl)-7-hydroxy-6-methylhept-2-enoic acid.
| Compound Name | (E,6S,7S)-7-(5-bromo-2-hydroxyphenyl)-7-hydroxy-6-methylhept-2-enoic acid |
|---|---|
| PubChem CID | 23749502 |
| Molecular Formula | C14H17BrO4 |
| Molecular Weight | 329.19 g/mol |
| Exact Mass | 328.03 |
| IUPAC Name | (E,6S,7S)-7-(5-bromo-2-hydroxyphenyl)-7-hydroxy-6-methylhept-2-enoic acid |
| SMILES | C[C@@H](CC/C=C/C(=O)O)[C@H](O)c1cc(Br)ccc1O |
| InChI | InChI=1S/C14H17BrO4/c1-9(4-2-3-5-13(17)18)14(19)11-8-10(15)6-7-12(11)16/h3,5-9,14,16,19H,2,4H2,1H3,(H,17,18)/b5-3+/t9-,14-/m0/s1 |
| InChIKey | HRWBTZSXTSHXMT-VHJHEKAJSA-N |
| XLogP | 3.25 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.19 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|