C14H18BrNO5 — CID 23749503
(E,6R,7R)-7-(5-bromo-2-hydroxyphenyl)-N,7-dihydroxy-6-methoxyhept-2-enamide (PubChem CID 23749503) has the molecular formula C14H18BrNO5 and a molecular weight of 360.20 g/mol. Its IUPAC name is (E,6R,7R)-7-(5-bromo-2-hydroxyphenyl)-N,7-dihydroxy-6-methoxyhept-2-enamide.
| Compound Name | (E,6R,7R)-7-(5-bromo-2-hydroxyphenyl)-N,7-dihydroxy-6-methoxyhept-2-enamide |
|---|---|
| PubChem CID | 23749503 |
| Molecular Formula | C14H18BrNO5 |
| Molecular Weight | 360.20 g/mol |
| Exact Mass | 359.04 |
| IUPAC Name | (E,6R,7R)-7-(5-bromo-2-hydroxyphenyl)-N,7-dihydroxy-6-methoxyhept-2-enamide |
| SMILES | CO[C@H](CC/C=C/C(=O)NO)[C@H](O)c1cc(Br)ccc1O |
| InChI | InChI=1S/C14H18BrNO5/c1-21-12(4-2-3-5-13(18)16-20)14(19)10-8-9(15)6-7-11(10)17/h3,5-8,12,14,17,19-20H,2,4H2,1H3,(H,16,18)/b5-3+/t12-,14-/m1/s1 |
| InChIKey | NIMXDPNESQSDEU-CLDOCUBWSA-N |
| XLogP | 2.04 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.20 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|