C15H20FNO4 — CID 23749509
(E,7S)-7-(3-fluoro-4-hydroxyphenyl)-N,7-dihydroxy-6,6-dimethylhept-2-enamide (PubChem CID 23749509) has the molecular formula C15H20FNO4 and a molecular weight of 297.33 g/mol. Its IUPAC name is (E,7S)-7-(3-fluoro-4-hydroxyphenyl)-N,7-dihydroxy-6,6-dimethylhept-2-enamide.
| Compound Name | (E,7S)-7-(3-fluoro-4-hydroxyphenyl)-N,7-dihydroxy-6,6-dimethylhept-2-enamide |
|---|---|
| PubChem CID | 23749509 |
| Molecular Formula | C15H20FNO4 |
| Molecular Weight | 297.33 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | (E,7S)-7-(3-fluoro-4-hydroxyphenyl)-N,7-dihydroxy-6,6-dimethylhept-2-enamide |
| SMILES | CC(C)(CC/C=C/C(=O)NO)[C@H](O)c1ccc(O)c(F)c1 |
| InChI | InChI=1S/C15H20FNO4/c1-15(2,8-4-3-5-13(19)17-21)14(20)10-6-7-12(18)11(16)9-10/h3,5-7,9,14,18,20-21H,4,8H2,1-2H3,(H,17,19)/b5-3+/t14-/m1/s1 |
| InChIKey | HXCFVHBVIDBVHG-LYKUJDHUSA-N |
| XLogP | 2.43 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.33 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|