C12H14FNO5 — CID 23749511
(E,4S,5S)-5-(3-fluoro-4-hydroxyphenyl)-N,5-dihydroxy-4-methoxypent-2-enamide (PubChem CID 23749511) has the molecular formula C12H14FNO5 and a molecular weight of 271.24 g/mol. Its IUPAC name is (E,4S,5S)-5-(3-fluoro-4-hydroxyphenyl)-N,5-dihydroxy-4-methoxypent-2-enamide.
| Compound Name | (E,4S,5S)-5-(3-fluoro-4-hydroxyphenyl)-N,5-dihydroxy-4-methoxypent-2-enamide |
|---|---|
| PubChem CID | 23749511 |
| Molecular Formula | C12H14FNO5 |
| Molecular Weight | 271.24 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | (E,4S,5S)-5-(3-fluoro-4-hydroxyphenyl)-N,5-dihydroxy-4-methoxypent-2-enamide |
| SMILES | CO[C@@H](/C=C/C(=O)NO)[C@@H](O)c1ccc(O)c(F)c1 |
| InChI | InChI=1S/C12H14FNO5/c1-19-10(4-5-11(16)14-18)12(17)7-2-3-9(15)8(13)6-7/h2-6,10,12,15,17-18H,1H3,(H,14,16)/b5-4+/t10-,12-/m0/s1 |
| InChIKey | UYZJDCMJARAFIP-XVHVLHHCSA-N |
| XLogP | 0.64 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.24 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|