C17H15FO5 — CID 23749513
(E,4S,5S)-5-(3-fluoro-4-hydroxyphenyl)-5-hydroxy-4-phenoxypent-2-enoic acid (PubChem CID 23749513) has the molecular formula C17H15FO5 and a molecular weight of 318.30 g/mol. Its IUPAC name is (E,4S,5S)-5-(3-fluoro-4-hydroxyphenyl)-5-hydroxy-4-phenoxypent-2-enoic acid.
| Compound Name | (E,4S,5S)-5-(3-fluoro-4-hydroxyphenyl)-5-hydroxy-4-phenoxypent-2-enoic acid |
|---|---|
| PubChem CID | 23749513 |
| Molecular Formula | C17H15FO5 |
| Molecular Weight | 318.30 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | (E,4S,5S)-5-(3-fluoro-4-hydroxyphenyl)-5-hydroxy-4-phenoxypent-2-enoic acid |
| SMILES | O=C(O)/C=C/[C@H](Oc1ccccc1)[C@@H](O)c1ccc(O)c(F)c1 |
| InChI | InChI=1S/C17H15FO5/c18-13-10-11(6-7-14(13)19)17(22)15(8-9-16(20)21)23-12-4-2-1-3-5-12/h1-10,15,17,19,22H,(H,20,21)/b9-8+/t15-,17-/m0/s1 |
| InChIKey | WVBGZVKITBZMQN-QFTYNREVSA-N |
| XLogP | 2.65 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.30 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|