About thiophen-2-ylmethyl furan-2-carboxylate
thiophen-2-ylmethyl furan-2-carboxylate (PubChem CID 2375148) has the molecular formula C10H8O3S
and a molecular weight of 208.24 g/mol. Its IUPAC name is thiophen-2-ylmethyl furan-2-carboxylate.
Molecular Properties
| Compound Name | thiophen-2-ylmethyl furan-2-carboxylate |
| PubChem CID | 2375148 |
| Molecular Formula | C10H8O3S |
| Molecular Weight | 208.24 g/mol |
| Exact Mass | 208.02 |
| IUPAC Name | thiophen-2-ylmethyl furan-2-carboxylate |
| SMILES | O=C(OCc1cccs1)c1ccco1 |
| InChI | InChI=1S/C10H8O3S/c11-10(9-4-1-5-12-9)13-7-8-3-2-6-14-8/h1-6H,7H2 |
| InChIKey | LZRWNUHWWOKSSY-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.24 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze thiophen-2-ylmethyl furan-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thiophen-2-ylmethyl furan-2-carboxylate?
The IUPAC name of thiophen-2-ylmethyl furan-2-carboxylate (CID 2375148) is thiophen-2-ylmethyl furan-2-carboxylate.
What is the SMILES notation for thiophen-2-ylmethyl furan-2-carboxylate?
The canonical SMILES for thiophen-2-ylmethyl furan-2-carboxylate is O=C(OCc1cccs1)c1ccco1.
What is the InChIKey of thiophen-2-ylmethyl furan-2-carboxylate?
The InChIKey is LZRWNUHWWOKSSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8O3S/c11-10(9-4-1-5-12-9)13-7-8-3-2-6-14-8/h1-6H,7H2.
What are the key properties of thiophen-2-ylmethyl furan-2-carboxylate?
thiophen-2-ylmethyl furan-2-carboxylate has a molecular weight of 208.24 g/mol, XLogP of 2.70, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for thiophen-2-ylmethyl furan-2-carboxylate is sourced from PubChem (CID 2375148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).