C25H42N2O5S — CID 23751677
ethyl (5S,6R,7S)-3-(4-hydroxybutyl)-7-methyl-4-oxo-2-(2,4,4-trimethylpentan-2-ylcarbamoyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23751677) has the molecular formula C25H42N2O5S and a molecular weight of 482.69 g/mol. Its IUPAC name is ethyl (5S,6R,7S)-3-(4-hydroxybutyl)-7-methyl-4-oxo-2-(2,4,4-trimethylpentan-2-ylcarbamoyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | ethyl (5S,6R,7S)-3-(4-hydroxybutyl)-7-methyl-4-oxo-2-(2,4,4-trimethylpentan-2-ylcarbamoyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23751677 |
| Molecular Formula | C25H42N2O5S |
| Molecular Weight | 482.69 g/mol |
| Exact Mass | 482.28 |
| IUPAC Name | ethyl (5S,6R,7S)-3-(4-hydroxybutyl)-7-methyl-4-oxo-2-(2,4,4-trimethylpentan-2-ylcarbamoyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | CCOC(=O)[C@H]1[C@H]2C(=O)N(CCCCO)C(C(=O)NC(C)(C)CC(C)(C)C)C23CC[C@]1(C)S3 |
| InChI | InChI=1S/C25H42N2O5S/c1-8-32-21(31)17-16-20(30)27(13-9-10-14-28)18(25(16)12-11-24(17,7)33-25)19(29)26-23(5,6)15-22(2,3)4/h16-18,28H,8-15H2,1-7H3,(H,26,29)/t16-,17+,18?,24-,25?/m0/s1 |
| InChIKey | FCRAESULNADCKW-XWTRMZHUSA-N |
| XLogP | 3.13 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.69 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|