C27H44N2O5S — CID 23751681
ethyl (5S,6R,7S)-3-(3-hydroxypropyl)-7-methyl-4-oxo-2-[prop-2-enyl(2,4,4-trimethylpentan-2-yl)carbamoyl]-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate (PubChem CID 23751681) has the molecular formula C27H44N2O5S and a molecular weight of 508.73 g/mol. Its IUPAC name is ethyl (5S,6R,7S)-3-(3-hydroxypropyl)-7-methyl-4-oxo-2-[prop-2-enyl(2,4,4-trimethylpentan-2-yl)carbamoyl]-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate.
| Compound Name | ethyl (5S,6R,7S)-3-(3-hydroxypropyl)-7-methyl-4-oxo-2-[prop-2-enyl(2,4,4-trimethylpentan-2-yl)carbamoyl]-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
|---|---|
| PubChem CID | 23751681 |
| Molecular Formula | C27H44N2O5S |
| Molecular Weight | 508.73 g/mol |
| Exact Mass | 508.30 |
| IUPAC Name | ethyl (5S,6R,7S)-3-(3-hydroxypropyl)-7-methyl-4-oxo-2-[prop-2-enyl(2,4,4-trimethylpentan-2-yl)carbamoyl]-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylate |
| SMILES | C=CCN(C(=O)C1N(CCCO)C(=O)[C@@H]2[C@H](C(=O)OCC)[C@]3(C)CCC12S3)C(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C27H44N2O5S/c1-9-14-29(25(6,7)17-24(3,4)5)22(32)20-27-13-12-26(8,35-27)19(23(33)34-10-2)18(27)21(31)28(20)15-11-16-30/h9,18-20,30H,1,10-17H2,2-8H3/t18-,19+,20?,26-,27?/m0/s1 |
| InChIKey | UGAQTLZVELVMCS-UXKXBWOISA-N |
| XLogP | 3.64 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.73 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|