C27H36N2O5S — CID 23752438
(5S,6R,7S)-2-[(2,6-dimethylphenyl)-prop-2-enylcarbamoyl]-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylic acid (PubChem CID 23752438) has the molecular formula C27H36N2O5S and a molecular weight of 500.66 g/mol. Its IUPAC name is (5S,6R,7S)-2-[(2,6-dimethylphenyl)-prop-2-enylcarbamoyl]-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylic acid.
| Compound Name | (5S,6R,7S)-2-[(2,6-dimethylphenyl)-prop-2-enylcarbamoyl]-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylic acid |
|---|---|
| PubChem CID | 23752438 |
| Molecular Formula | C27H36N2O5S |
| Molecular Weight | 500.66 g/mol |
| Exact Mass | 500.23 |
| IUPAC Name | (5S,6R,7S)-2-[(2,6-dimethylphenyl)-prop-2-enylcarbamoyl]-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-4-oxo-10-thia-3-azatricyclo[5.2.1.01,5]decane-6-carboxylic acid |
| SMILES | C=CCN(C(=O)C1N(C(CO)CC(C)C)C(=O)[C@@H]2[C@H](C(=O)O)[C@@H]3CCC12S3)c1c(C)cccc1C |
| InChI | InChI=1S/C27H36N2O5S/c1-6-12-28(22-16(4)8-7-9-17(22)5)25(32)23-27-11-10-19(35-27)20(26(33)34)21(27)24(31)29(23)18(14-30)13-15(2)3/h6-9,15,18-21,23,30H,1,10-14H2,2-5H3,(H,33,34)/t18?,19-,20+,21-,23?,27?/m0/s1 |
| InChIKey | MSDHIBZARVKMAE-XGEYAADHSA-N |
| XLogP | 3.41 |
| TPSA | 98.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.66 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|