C39H45N3O5 — CID 23753339
(5R,6S,7S)-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-7-methyl-2-N-naphthalen-2-yl-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23753339) has the molecular formula C39H45N3O5 and a molecular weight of 635.81 g/mol. Its IUPAC name is (5R,6S,7S)-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-7-methyl-2-N-naphthalen-2-yl-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6S,7S)-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-7-methyl-2-N-naphthalen-2-yl-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23753339 |
| Molecular Formula | C39H45N3O5 |
| Molecular Weight | 635.81 g/mol |
| Exact Mass | 635.34 |
| IUPAC Name | (5R,6S,7S)-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-7-methyl-2-N-naphthalen-2-yl-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(C(=O)C1N([C@@H](CO)CC(C)C)C(=O)[C@@H]2[C@H](C(=O)N(CC=C)c3ccccc3)[C@]3(C)CCC12O3)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C39H45N3O5/c1-6-21-40(29-15-9-8-10-16-29)35(44)32-33-36(45)42(31(25-43)23-26(3)4)34(39(33)20-19-38(32,5)47-39)37(46)41(22-7-2)30-18-17-27-13-11-12-14-28(27)24-30/h6-18,24,26,31-34,43H,1-2,19-23,25H2,3-5H3/t31-,32-,33+,34?,38+,39?/m1/s1 |
| InChIKey | SKRYUDFUBOXHSE-SGLCVNSLSA-N |
| XLogP | 5.75 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.81 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|