C30H48N4O5S — CID 23754021
(5S,6R,7S)-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-6-N,7-dimethyl-2-N-(2-morpholin-4-ylethyl)-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23754021) has the molecular formula C30H48N4O5S and a molecular weight of 576.80 g/mol. Its IUPAC name is (5S,6R,7S)-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-6-N,7-dimethyl-2-N-(2-morpholin-4-ylethyl)-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6R,7S)-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-6-N,7-dimethyl-2-N-(2-morpholin-4-ylethyl)-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23754021 |
| Molecular Formula | C30H48N4O5S |
| Molecular Weight | 576.80 g/mol |
| Exact Mass | 576.33 |
| IUPAC Name | (5S,6R,7S)-3-[(2R)-1-hydroxy-4-methylpentan-2-yl]-6-N,7-dimethyl-2-N-(2-morpholin-4-ylethyl)-4-oxo-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(C)C(=O)[C@H]1[C@H]2C(=O)N([C@@H](CO)CC(C)C)C(C(=O)N(CC=C)CCN3CCOCC3)C23CC[C@]1(C)S3 |
| InChI | InChI=1S/C30H48N4O5S/c1-7-11-31(6)26(36)23-24-27(37)34(22(20-35)19-21(3)4)25(30(24)10-9-29(23,5)40-30)28(38)33(12-8-2)14-13-32-15-17-39-18-16-32/h7-8,21-25,35H,1-2,9-20H2,3-6H3/t22-,23-,24+,25?,29+,30?/m1/s1 |
| InChIKey | VZHMUQSCVXUOPB-VGBIPRIWSA-N |
| XLogP | 1.87 |
| TPSA | 93.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.80 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|