C28H31N3O2S — CID 2375425
(2Z)-2-cyano-2-[(5Z)-5-[(4-methylphenyl)methylidene]-4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene]-N-octylacetamide (PubChem CID 2375425) has the molecular formula C28H31N3O2S and a molecular weight of 473.64 g/mol. Its IUPAC name is (2Z)-2-cyano-2-[(5Z)-5-[(4-methylphenyl)methylidene]-4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene]-N-octylacetamide.
| Compound Name | (2Z)-2-cyano-2-[(5Z)-5-[(4-methylphenyl)methylidene]-4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene]-N-octylacetamide |
|---|---|
| PubChem CID | 2375425 |
| Molecular Formula | C28H31N3O2S |
| Molecular Weight | 473.64 g/mol |
| Exact Mass | 473.21 |
| IUPAC Name | (2Z)-2-cyano-2-[(5Z)-5-[(4-methylphenyl)methylidene]-4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene]-N-octylacetamide |
| SMILES | CCCCCCCCNC(=O)/C(C#N)=c1\s/c(=C\c2ccc(C)cc2)c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C28H31N3O2S/c1-3-4-5-6-7-11-18-30-26(32)24(20-29)28-31(23-12-9-8-10-13-23)27(33)25(34-28)19-22-16-14-21(2)15-17-22/h8-10,12-17,19H,3-7,11,18H2,1-2H3,(H,30,32)/b25-19-,28-24- |
| InChIKey | WVCSEZPCSJKZIZ-JFIVWTSXSA-N |
| XLogP | 4.19 |
| TPSA | 74.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.64 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|