About [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] 4-hydroxybenzoate
[2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] 4-hydroxybenzoate (PubChem CID 2375578) has the molecular formula C14H10Cl2N2O4
and a molecular weight of 341.15 g/mol. Its IUPAC name is [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] 4-hydroxybenzoate.
Molecular Properties
| Compound Name | [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] 4-hydroxybenzoate |
| PubChem CID | 2375578 |
| Molecular Formula | C14H10Cl2N2O4 |
| Molecular Weight | 341.15 g/mol |
| Exact Mass | 340.00 |
| IUPAC Name | [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] 4-hydroxybenzoate |
| SMILES | O=C(COC(=O)c1ccc(O)cc1)Nc1ncc(Cl)cc1Cl |
| InChI | InChI=1S/C14H10Cl2N2O4/c15-9-5-11(16)13(17-6-9)18-12(20)7-22-14(21)8-1-3-10(19)4-2-8/h1-6,19H,7H2,(H,17,18,20) |
| InChIKey | YRRGUOZZPQIRQK-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.15 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] 4-hydroxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] 4-hydroxybenzoate?
The IUPAC name of [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] 4-hydroxybenzoate (CID 2375578) is [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] 4-hydroxybenzoate.
What is the SMILES notation for [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] 4-hydroxybenzoate?
The canonical SMILES for [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] 4-hydroxybenzoate is O=C(COC(=O)c1ccc(O)cc1)Nc1ncc(Cl)cc1Cl.
What is the InChIKey of [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] 4-hydroxybenzoate?
The InChIKey is YRRGUOZZPQIRQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10Cl2N2O4/c15-9-5-11(16)13(17-6-9)18-12(20)7-22-14(21)8-1-3-10(19)4-2-8/h1-6,19H,7H2,(H,17,18,20).
What are the key properties of [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] 4-hydroxybenzoate?
[2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] 4-hydroxybenzoate has a molecular weight of 341.15 g/mol, XLogP of 2.89, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] 4-hydroxybenzoate is sourced from PubChem (CID 2375578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).