C23H34O7 — CID 23757107
methyl (1R,4S,4aS,5R,7R,8S,9R)-9-acetyloxy-7-ethenyl-4,5,8-trihydroxy-1,4a,7-trimethyl-3,4,5,6,8,9,10,10a-octahydro-2H-phenanthrene-1-carboxylate (PubChem CID 23757107) has the molecular formula C23H34O7 and a molecular weight of 422.52 g/mol. Its IUPAC name is methyl (1R,4S,4aS,5R,7R,8S,9R)-9-acetyloxy-7-ethenyl-4,5,8-trihydroxy-1,4a,7-trimethyl-3,4,5,6,8,9,10,10a-octahydro-2H-phenanthrene-1-carboxylate.
| Compound Name | methyl (1R,4S,4aS,5R,7R,8S,9R)-9-acetyloxy-7-ethenyl-4,5,8-trihydroxy-1,4a,7-trimethyl-3,4,5,6,8,9,10,10a-octahydro-2H-phenanthrene-1-carboxylate |
|---|---|
| PubChem CID | 23757107 |
| Molecular Formula | C23H34O7 |
| Molecular Weight | 422.52 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | methyl (1R,4S,4aS,5R,7R,8S,9R)-9-acetyloxy-7-ethenyl-4,5,8-trihydroxy-1,4a,7-trimethyl-3,4,5,6,8,9,10,10a-octahydro-2H-phenanthrene-1-carboxylate |
| SMILES | C=C[C@@]1(C)C[C@@H](O)C2=C([C@H]1O)[C@H](OC(C)=O)CC1[C@](C)(C(=O)OC)CC[C@H](O)[C@]21C |
| InChI | InChI=1S/C23H34O7/c1-7-21(3)11-13(25)18-17(19(21)27)14(30-12(2)24)10-15-22(4,20(28)29-6)9-8-16(26)23(15,18)5/h7,13-16,19,25-27H,1,8-11H2,2-6H3/t13-,14-,15?,16+,19-,21+,22-,23-/m1/s1 |
| InChIKey | OKEBEOPRWZEJIC-WYXNHFBDSA-N |
| XLogP | 1.89 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.52 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|