C15H20O4 — CID 23757251
(6E,10S,11aR)-3-(hydroxymethyl)-6,10-dimethyl-4,5,8,10,11,11a-hexahydrocyclodeca[b]furan-2,9-dione (PubChem CID 23757251) has the molecular formula C15H20O4 and a molecular weight of 264.32 g/mol. Its IUPAC name is (6E,10S,11aR)-3-(hydroxymethyl)-6,10-dimethyl-4,5,8,10,11,11a-hexahydrocyclodeca[b]furan-2,9-dione.
| Compound Name | (6E,10S,11aR)-3-(hydroxymethyl)-6,10-dimethyl-4,5,8,10,11,11a-hexahydrocyclodeca[b]furan-2,9-dione |
|---|---|
| PubChem CID | 23757251 |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | (6E,10S,11aR)-3-(hydroxymethyl)-6,10-dimethyl-4,5,8,10,11,11a-hexahydrocyclodeca[b]furan-2,9-dione |
| SMILES | C/C1=C\CC(=O)[C@@H](C)C[C@H]2OC(=O)C(CO)=C2CC1 |
| InChI | InChI=1S/C15H20O4/c1-9-3-5-11-12(8-16)15(18)19-14(11)7-10(2)13(17)6-4-9/h4,10,14,16H,3,5-8H2,1-2H3/b9-4+/t10-,14+/m0/s1 |
| InChIKey | DPKLHUJIQNJYBQ-BRMKLWRISA-N |
| XLogP | 1.93 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|