C28H36N2O6Si — CID 23758092
(3S,3'S,4'R,5'S)-4'-[hydroxy(dimethyl)silyl]-5'-[2-[(3S)-3-(hydroxymethyl)-3,4-dihydro-1H-isoquinolin-2-yl]-2-oxoethyl]-5-methoxy-1,3'-dimethylspiro[indole-3,2'-oxolane]-2-one (PubChem CID 23758092) has the molecular formula C28H36N2O6Si and a molecular weight of 524.69 g/mol. Its IUPAC name is (3S,3'S,4'R,5'S)-4'-[hydroxy(dimethyl)silyl]-5'-[2-[(3S)-3-(hydroxymethyl)-3,4-dihydro-1H-isoquinolin-2-yl]-2-oxoethyl]-5-methoxy-1,3'-dimethylspiro[indole-3,2'-oxolane]-2-one.
| Compound Name | (3S,3'S,4'R,5'S)-4'-[hydroxy(dimethyl)silyl]-5'-[2-[(3S)-3-(hydroxymethyl)-3,4-dihydro-1H-isoquinolin-2-yl]-2-oxoethyl]-5-methoxy-1,3'-dimethylspiro[indole-3,2'-oxolane]-2-one |
|---|---|
| PubChem CID | 23758092 |
| Molecular Formula | C28H36N2O6Si |
| Molecular Weight | 524.69 g/mol |
| Exact Mass | 524.23 |
| IUPAC Name | (3S,3'S,4'R,5'S)-4'-[hydroxy(dimethyl)silyl]-5'-[2-[(3S)-3-(hydroxymethyl)-3,4-dihydro-1H-isoquinolin-2-yl]-2-oxoethyl]-5-methoxy-1,3'-dimethylspiro[indole-3,2'-oxolane]-2-one |
| SMILES | COc1ccc2c(c1)[C@]1(O[C@@H](CC(=O)N3Cc4ccccc4C[C@H]3CO)[C@H]([Si](C)(C)O)[C@H]1C)C(=O)N2C |
| InChI | InChI=1S/C28H36N2O6Si/c1-17-26(37(4,5)34)24(14-25(32)30-15-19-9-7-6-8-18(19)12-20(30)16-31)36-28(17)22-13-21(35-3)10-11-23(22)29(2)27(28)33/h6-11,13,17,20,24,26,31,34H,12,14-16H2,1-5H3/t17-,20+,24+,26-,28+/m1/s1 |
| InChIKey | VMJWUSBNTMXZMO-DAHWEMFHSA-N |
| XLogP | 2.81 |
| TPSA | 99.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.69 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|