C28H27N3O2 — CID 23758739
7-(1,3-benzodioxol-5-yl)-1,3,3,4,12-pentamethylbenzo[b][1,7]phenanthrolin-10-imine (PubChem CID 23758739) has the molecular formula C28H27N3O2 and a molecular weight of 437.54 g/mol. Its IUPAC name is 7-(1,3-benzodioxol-5-yl)-1,3,3,4,12-pentamethylbenzo[b][1,7]phenanthrolin-10-imine.
| Compound Name | 7-(1,3-benzodioxol-5-yl)-1,3,3,4,12-pentamethylbenzo[b][1,7]phenanthrolin-10-imine |
|---|---|
| PubChem CID | 23758739 |
| Molecular Formula | C28H27N3O2 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.21 |
| IUPAC Name | 7-(1,3-benzodioxol-5-yl)-1,3,3,4,12-pentamethylbenzo[b][1,7]phenanthrolin-10-imine |
| SMILES | [H]/N=c1\ccc2c(-c3ccc4c(c3)OCO4)c3ccc4c(c3n(C)c-2c1)C(C)=CC(C)(C)N4C |
| InChI | InChI=1S/C28H27N3O2/c1-16-14-28(2,3)31(5)21-10-9-20-26(17-6-11-23-24(12-17)33-15-32-23)19-8-7-18(29)13-22(19)30(4)27(20)25(16)21/h6-14,29H,15H2,1-5H3/b29-18+ |
| InChIKey | SUZWWAOPQSLRPV-RDRPBHBLSA-N |
| XLogP | 5.79 |
| TPSA | 50.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|