C25H27N3 — CID 23758777
9-(3,5-dimethylphenyl)-6-N,6-N-diethylacridine-3,6-diamine (PubChem CID 23758777) has the molecular formula C25H27N3 and a molecular weight of 369.51 g/mol. Its IUPAC name is 9-(3,5-dimethylphenyl)-6-N,6-N-diethylacridine-3,6-diamine.
| Compound Name | 9-(3,5-dimethylphenyl)-6-N,6-N-diethylacridine-3,6-diamine |
|---|---|
| PubChem CID | 23758777 |
| Molecular Formula | C25H27N3 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.22 |
| IUPAC Name | 9-(3,5-dimethylphenyl)-6-N,6-N-diethylacridine-3,6-diamine |
| SMILES | CCN(CC)c1ccc2c(-c3cc(C)cc(C)c3)c3ccc(N)cc3nc2c1 |
| InChI | InChI=1S/C25H27N3/c1-5-28(6-2)20-8-10-22-24(15-20)27-23-14-19(26)7-9-21(23)25(22)18-12-16(3)11-17(4)13-18/h7-15H,5-6,26H2,1-4H3 |
| InChIKey | LXFOVZTZZGMSJZ-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|