About 6-N,6-N-diethyl-9-(3-fluorophenyl)acridine-3,6-diamine
6-N,6-N-diethyl-9-(3-fluorophenyl)acridine-3,6-diamine (PubChem CID 23758783) has the molecular formula C23H22FN3
and a molecular weight of 359.45 g/mol. Its IUPAC name is 6-N,6-N-diethyl-9-(3-fluorophenyl)acridine-3,6-diamine.
Molecular Properties
| Compound Name | 6-N,6-N-diethyl-9-(3-fluorophenyl)acridine-3,6-diamine |
| PubChem CID | 23758783 |
| Molecular Formula | C23H22FN3 |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | 6-N,6-N-diethyl-9-(3-fluorophenyl)acridine-3,6-diamine |
| SMILES | CCN(CC)c1ccc2c(-c3cccc(F)c3)c3ccc(N)cc3nc2c1 |
| InChI | InChI=1S/C23H22FN3/c1-3-27(4-2)18-9-11-20-22(14-18)26-21-13-17(25)8-10-19(21)23(20)15-6-5-7-16(24)12-15/h5-14H,3-4,25H2,1-2H3 |
| InChIKey | SLQLWDBWXXFBET-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 6-N,6-N-diethyl-9-(3-fluorophenyl)acridine-3,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-N,6-N-diethyl-9-(3-fluorophenyl)acridine-3,6-diamine?
The IUPAC name of 6-N,6-N-diethyl-9-(3-fluorophenyl)acridine-3,6-diamine (CID 23758783) is 6-N,6-N-diethyl-9-(3-fluorophenyl)acridine-3,6-diamine.
What is the SMILES notation for 6-N,6-N-diethyl-9-(3-fluorophenyl)acridine-3,6-diamine?
The canonical SMILES for 6-N,6-N-diethyl-9-(3-fluorophenyl)acridine-3,6-diamine is CCN(CC)c1ccc2c(-c3cccc(F)c3)c3ccc(N)cc3nc2c1.
What is the InChIKey of 6-N,6-N-diethyl-9-(3-fluorophenyl)acridine-3,6-diamine?
The InChIKey is SLQLWDBWXXFBET-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22FN3/c1-3-27(4-2)18-9-11-20-22(14-18)26-21-13-17(25)8-10-19(21)23(20)15-6-5-7-16(24)12-15/h5-14H,3-4,25H2,1-2H3.
What are the key properties of 6-N,6-N-diethyl-9-(3-fluorophenyl)acridine-3,6-diamine?
6-N,6-N-diethyl-9-(3-fluorophenyl)acridine-3,6-diamine has a molecular weight of 359.45 g/mol, XLogP of 5.62, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-N,6-N-diethyl-9-(3-fluorophenyl)acridine-3,6-diamine is sourced from PubChem (CID 23758783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).