C33H42N4O7 — CID 23760389
N'-hydroxy-N-[(E)-[4-[[(2S,3S,8E)-3-(methoxymethyl)-5,12-dioxo-2-phenyl-1-oxa-4-azacyclododec-8-en-4-yl]methyl]phenyl]methylideneamino]heptanediamide (PubChem CID 23760389) has the molecular formula C33H42N4O7 and a molecular weight of 606.72 g/mol. Its IUPAC name is N'-hydroxy-N-[(E)-[4-[[(2S,3S,8E)-3-(methoxymethyl)-5,12-dioxo-2-phenyl-1-oxa-4-azacyclododec-8-en-4-yl]methyl]phenyl]methylideneamino]heptanediamide.
| Compound Name | N'-hydroxy-N-[(E)-[4-[[(2S,3S,8E)-3-(methoxymethyl)-5,12-dioxo-2-phenyl-1-oxa-4-azacyclododec-8-en-4-yl]methyl]phenyl]methylideneamino]heptanediamide |
|---|---|
| PubChem CID | 23760389 |
| Molecular Formula | C33H42N4O7 |
| Molecular Weight | 606.72 g/mol |
| Exact Mass | 606.31 |
| IUPAC Name | N'-hydroxy-N-[(E)-[4-[[(2S,3S,8E)-3-(methoxymethyl)-5,12-dioxo-2-phenyl-1-oxa-4-azacyclododec-8-en-4-yl]methyl]phenyl]methylideneamino]heptanediamide |
| SMILES | COC[C@H]1[C@H](c2ccccc2)OC(=O)CC/C=C/CCC(=O)N1Cc1ccc(/C=N/NC(=O)CCCCCC(=O)NO)cc1 |
| InChI | InChI=1S/C33H42N4O7/c1-43-24-28-33(27-12-6-4-7-13-27)44-32(41)17-11-3-2-10-16-31(40)37(28)23-26-20-18-25(19-21-26)22-34-35-29(38)14-8-5-9-15-30(39)36-42/h2-4,6-7,12-13,18-22,28,33,42H,5,8-11,14-17,23-24H2,1H3,(H,35,38)(H,36,39)/b3-2+,34-22+/t28-,33-/m0/s1 |
| InChIKey | BVJVODHJSDUMQA-ZONMICCXSA-N |
| XLogP | 4.35 |
| TPSA | 146.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.72 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|