About N-ethyl-4-methyl-1,3-benzothiazol-2-amine
N-ethyl-4-methyl-1,3-benzothiazol-2-amine (PubChem CID 2376040) has the molecular formula C10H12N2S
and a molecular weight of 192.29 g/mol. Its IUPAC name is N-ethyl-4-methyl-1,3-benzothiazol-2-amine.
Molecular Properties
| Compound Name | N-ethyl-4-methyl-1,3-benzothiazol-2-amine |
| PubChem CID | 2376040 |
| Molecular Formula | C10H12N2S |
| Molecular Weight | 192.29 g/mol |
| Exact Mass | 192.07 |
| IUPAC Name | N-ethyl-4-methyl-1,3-benzothiazol-2-amine |
| SMILES | CCNc1nc2c(C)cccc2s1 |
| InChI | InChI=1S/C10H12N2S/c1-3-11-10-12-9-7(2)5-4-6-8(9)13-10/h4-6H,3H2,1-2H3,(H,11,12) |
| InChIKey | GZEPBFKXMZBPFQ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.29 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-ethyl-4-methyl-1,3-benzothiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-4-methyl-1,3-benzothiazol-2-amine?
The IUPAC name of N-ethyl-4-methyl-1,3-benzothiazol-2-amine (CID 2376040) is N-ethyl-4-methyl-1,3-benzothiazol-2-amine.
What is the SMILES notation for N-ethyl-4-methyl-1,3-benzothiazol-2-amine?
The canonical SMILES for N-ethyl-4-methyl-1,3-benzothiazol-2-amine is CCNc1nc2c(C)cccc2s1.
What is the InChIKey of N-ethyl-4-methyl-1,3-benzothiazol-2-amine?
The InChIKey is GZEPBFKXMZBPFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2S/c1-3-11-10-12-9-7(2)5-4-6-8(9)13-10/h4-6H,3H2,1-2H3,(H,11,12).
What are the key properties of N-ethyl-4-methyl-1,3-benzothiazol-2-amine?
N-ethyl-4-methyl-1,3-benzothiazol-2-amine has a molecular weight of 192.29 g/mol, XLogP of 3.04, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-4-methyl-1,3-benzothiazol-2-amine is sourced from PubChem (CID 2376040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).