C24H29FN4O6 — CID 23760598
(2R,3R,4S)-2-ethoxy-4-(4-fluorophenyl)-3-(3-hydroxypropyl)-N-[2-[(5-nitro-2-pyridinyl)amino]ethyl]-3,4-dihydro-2H-pyran-6-carboxamide (PubChem CID 23760598) has the molecular formula C24H29FN4O6 and a molecular weight of 488.52 g/mol. Its IUPAC name is (2R,3R,4S)-2-ethoxy-4-(4-fluorophenyl)-3-(3-hydroxypropyl)-N-[2-[(5-nitro-2-pyridinyl)amino]ethyl]-3,4-dihydro-2H-pyran-6-carboxamide.
| Compound Name | (2R,3R,4S)-2-ethoxy-4-(4-fluorophenyl)-3-(3-hydroxypropyl)-N-[2-[(5-nitro-2-pyridinyl)amino]ethyl]-3,4-dihydro-2H-pyran-6-carboxamide |
|---|---|
| PubChem CID | 23760598 |
| Molecular Formula | C24H29FN4O6 |
| Molecular Weight | 488.52 g/mol |
| Exact Mass | 488.21 |
| IUPAC Name | (2R,3R,4S)-2-ethoxy-4-(4-fluorophenyl)-3-(3-hydroxypropyl)-N-[2-[(5-nitro-2-pyridinyl)amino]ethyl]-3,4-dihydro-2H-pyran-6-carboxamide |
| SMILES | CCO[C@@H]1OC(C(=O)NCCNc2ccc([N+](=O)[O-])cn2)=C[C@H](c2ccc(F)cc2)[C@H]1CCCO |
| InChI | InChI=1S/C24H29FN4O6/c1-2-34-24-19(4-3-13-30)20(16-5-7-17(25)8-6-16)14-21(35-24)23(31)27-12-11-26-22-10-9-18(15-28-22)29(32)33/h5-10,14-15,19-20,24,30H,2-4,11-13H2,1H3,(H,26,28)(H,27,31)/t19-,20-,24-/m1/s1 |
| InChIKey | AIQHDWHLLBZIRZ-YOSAUDMPSA-N |
| XLogP | 3.11 |
| TPSA | 135.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.52 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|