C20H28N4O3S — CID 23760902
N-ethyl-1-(3-methylthiophen-2-yl)-6-oxo-3-(piperazine-1-carbonyl)-1,3,3a,4,5,6a-hexahydrocyclopenta[c]pyrrole-2-carboxamide (PubChem CID 23760902) has the molecular formula C20H28N4O3S and a molecular weight of 404.54 g/mol. Its IUPAC name is N-ethyl-1-(3-methylthiophen-2-yl)-6-oxo-3-(piperazine-1-carbonyl)-1,3,3a,4,5,6a-hexahydrocyclopenta[c]pyrrole-2-carboxamide.
| Compound Name | N-ethyl-1-(3-methylthiophen-2-yl)-6-oxo-3-(piperazine-1-carbonyl)-1,3,3a,4,5,6a-hexahydrocyclopenta[c]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 23760902 |
| Molecular Formula | C20H28N4O3S |
| Molecular Weight | 404.54 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | N-ethyl-1-(3-methylthiophen-2-yl)-6-oxo-3-(piperazine-1-carbonyl)-1,3,3a,4,5,6a-hexahydrocyclopenta[c]pyrrole-2-carboxamide |
| SMILES | CCNC(=O)N1C(C(=O)N2CCNCC2)C2CCC(=O)C2C1c1sccc1C |
| InChI | InChI=1S/C20H28N4O3S/c1-3-22-20(27)24-16(19(26)23-9-7-21-8-10-23)13-4-5-14(25)15(13)17(24)18-12(2)6-11-28-18/h6,11,13,15-17,21H,3-5,7-10H2,1-2H3,(H,22,27) |
| InChIKey | RDOOHEMBVGFVMC-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.54 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |