C25H38N4S — CID 2376136
5-(4-tert-butylphenyl)-4-[(1R,2R)-2-methylcyclohexyl]-2-(piperidin-1-ylmethyl)-1,2,4-triazole-3-thione (PubChem CID 2376136) has the molecular formula C25H38N4S and a molecular weight of 426.67 g/mol. Its IUPAC name is 5-(4-tert-butylphenyl)-4-[(1R,2R)-2-methylcyclohexyl]-2-(piperidin-1-ylmethyl)-1,2,4-triazole-3-thione.
| Compound Name | 5-(4-tert-butylphenyl)-4-[(1R,2R)-2-methylcyclohexyl]-2-(piperidin-1-ylmethyl)-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 2376136 |
| Molecular Formula | C25H38N4S |
| Molecular Weight | 426.67 g/mol |
| Exact Mass | 426.28 |
| IUPAC Name | 5-(4-tert-butylphenyl)-4-[(1R,2R)-2-methylcyclohexyl]-2-(piperidin-1-ylmethyl)-1,2,4-triazole-3-thione |
| SMILES | C[C@@H]1CCCC[C@H]1n1c(-c2ccc(C(C)(C)C)cc2)nn(CN2CCCCC2)c1=S |
| InChI | InChI=1S/C25H38N4S/c1-19-10-6-7-11-22(19)29-23(20-12-14-21(15-13-20)25(2,3)4)26-28(24(29)30)18-27-16-8-5-9-17-27/h12-15,19,22H,5-11,16-18H2,1-4H3/t19-,22-/m1/s1 |
| InChIKey | COXAQTAYYXUWOZ-DENIHFKCSA-N |
| XLogP | 6.57 |
| TPSA | 25.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.67 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|