C20H19FN2S — CID 23761424
N-(4-fluorophenyl)-4-methyl-3-(1,2,3,4-tetrahydronaphthalen-1-yl)-1,3-thiazol-2-imine (PubChem CID 23761424) has the molecular formula C20H19FN2S and a molecular weight of 338.45 g/mol. Its IUPAC name is N-(4-fluorophenyl)-4-methyl-3-(1,2,3,4-tetrahydronaphthalen-1-yl)-1,3-thiazol-2-imine.
| Compound Name | N-(4-fluorophenyl)-4-methyl-3-(1,2,3,4-tetrahydronaphthalen-1-yl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23761424 |
| Molecular Formula | C20H19FN2S |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | N-(4-fluorophenyl)-4-methyl-3-(1,2,3,4-tetrahydronaphthalen-1-yl)-1,3-thiazol-2-imine |
| SMILES | Cc1cs/c(=N\c2ccc(F)cc2)n1C1CCCc2ccccc21 |
| InChI | InChI=1S/C20H19FN2S/c1-14-13-24-20(22-17-11-9-16(21)10-12-17)23(14)19-8-4-6-15-5-2-3-7-18(15)19/h2-3,5,7,9-13,19H,4,6,8H2,1H3/b22-20- |
| InChIKey | FEMCYQMLHXJZPZ-XDOYNYLZSA-N |
| XLogP | 5.16 |
| TPSA | 17.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|