C22H15Cl3N2O3 — CID 23761603
N-[3-(5-methyl-1,3-benzoxazol-2-yl)phenyl]-2-(2,4,5-trichlorophenoxy)acetamide (PubChem CID 23761603) has the molecular formula C22H15Cl3N2O3 and a molecular weight of 461.73 g/mol. Its IUPAC name is N-[3-(5-methyl-1,3-benzoxazol-2-yl)phenyl]-2-(2,4,5-trichlorophenoxy)acetamide.
| Compound Name | N-[3-(5-methyl-1,3-benzoxazol-2-yl)phenyl]-2-(2,4,5-trichlorophenoxy)acetamide |
|---|---|
| PubChem CID | 23761603 |
| Molecular Formula | C22H15Cl3N2O3 |
| Molecular Weight | 461.73 g/mol |
| Exact Mass | 460.01 |
| IUPAC Name | N-[3-(5-methyl-1,3-benzoxazol-2-yl)phenyl]-2-(2,4,5-trichlorophenoxy)acetamide |
| SMILES | Cc1ccc2oc(-c3cccc(NC(=O)COc4cc(Cl)c(Cl)cc4Cl)c3)nc2c1 |
| InChI | InChI=1S/C22H15Cl3N2O3/c1-12-5-6-19-18(7-12)27-22(30-19)13-3-2-4-14(8-13)26-21(28)11-29-20-10-16(24)15(23)9-17(20)25/h2-10H,11H2,1H3,(H,26,28) |
| InChIKey | FXHNAGMCRHYLBY-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.73 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|