C13H14N2O2S2 — CID 2376201
(2R)-2-[(2-anilino-1,3-thiazol-4-yl)methylsulfanyl]propanoic acid (PubChem CID 2376201) has the molecular formula C13H14N2O2S2 and a molecular weight of 294.40 g/mol. Its IUPAC name is (2R)-2-[(2-anilino-1,3-thiazol-4-yl)methylsulfanyl]propanoic acid.
| Compound Name | (2R)-2-[(2-anilino-1,3-thiazol-4-yl)methylsulfanyl]propanoic acid |
|---|---|
| PubChem CID | 2376201 |
| Molecular Formula | C13H14N2O2S2 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.05 |
| IUPAC Name | (2R)-2-[(2-anilino-1,3-thiazol-4-yl)methylsulfanyl]propanoic acid |
| SMILES | C[C@@H](SCc1csc(Nc2ccccc2)n1)C(=O)O |
| InChI | InChI=1S/C13H14N2O2S2/c1-9(12(16)17)18-7-11-8-19-13(15-11)14-10-5-3-2-4-6-10/h2-6,8-9H,7H2,1H3,(H,14,15)(H,16,17)/t9-/m1/s1 |
| InChIKey | JLHNZUNNQDQRHQ-SECBINFHSA-N |
| XLogP | 3.59 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |