About 6-chloro-5-hydroxy-4-(morpholin-4-ylmethyl)-1,3-benzoxathiol-2-one
6-chloro-5-hydroxy-4-(morpholin-4-ylmethyl)-1,3-benzoxathiol-2-one (PubChem CID 23762590) has the molecular formula C12H12ClNO4S
and a molecular weight of 301.75 g/mol. Its IUPAC name is 6-chloro-5-hydroxy-4-(morpholin-4-ylmethyl)-1,3-benzoxathiol-2-one.
Molecular Properties
| Compound Name | 6-chloro-5-hydroxy-4-(morpholin-4-ylmethyl)-1,3-benzoxathiol-2-one |
| PubChem CID | 23762590 |
| Molecular Formula | C12H12ClNO4S |
| Molecular Weight | 301.75 g/mol |
| Exact Mass | 301.02 |
| IUPAC Name | 6-chloro-5-hydroxy-4-(morpholin-4-ylmethyl)-1,3-benzoxathiol-2-one |
| SMILES | O=c1oc2cc(Cl)c(O)c(CN3CCOCC3)c2s1 |
| InChI | InChI=1S/C12H12ClNO4S/c13-8-5-9-11(19-12(16)18-9)7(10(8)15)6-14-1-3-17-4-2-14/h5,15H,1-4,6H2 |
| InChIKey | NSQYDAQCYQVWLZ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 62.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.75 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'thio_carbonate_A(15)', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-5-hydroxy-4-(morpholin-4-ylmethyl)-1,3-benzoxathiol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-5-hydroxy-4-(morpholin-4-ylmethyl)-1,3-benzoxathiol-2-one?
The IUPAC name of 6-chloro-5-hydroxy-4-(morpholin-4-ylmethyl)-1,3-benzoxathiol-2-one (CID 23762590) is 6-chloro-5-hydroxy-4-(morpholin-4-ylmethyl)-1,3-benzoxathiol-2-one.
What is the SMILES notation for 6-chloro-5-hydroxy-4-(morpholin-4-ylmethyl)-1,3-benzoxathiol-2-one?
The canonical SMILES for 6-chloro-5-hydroxy-4-(morpholin-4-ylmethyl)-1,3-benzoxathiol-2-one is O=c1oc2cc(Cl)c(O)c(CN3CCOCC3)c2s1.
What is the InChIKey of 6-chloro-5-hydroxy-4-(morpholin-4-ylmethyl)-1,3-benzoxathiol-2-one?
The InChIKey is NSQYDAQCYQVWLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12ClNO4S/c13-8-5-9-11(19-12(16)18-9)7(10(8)15)6-14-1-3-17-4-2-14/h5,15H,1-4,6H2.
What are the key properties of 6-chloro-5-hydroxy-4-(morpholin-4-ylmethyl)-1,3-benzoxathiol-2-one?
6-chloro-5-hydroxy-4-(morpholin-4-ylmethyl)-1,3-benzoxathiol-2-one has a molecular weight of 301.75 g/mol, XLogP of 2.05, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-5-hydroxy-4-(morpholin-4-ylmethyl)-1,3-benzoxathiol-2-one is sourced from PubChem (CID 23762590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).