C25H24FN3O3 — CID 23763104
N-[1-(3-ethyl-6-methyl-4-oxoquinazolin-2-yl)ethyl]-4-fluoro-N-(furan-2-ylmethyl)benzamide (PubChem CID 23763104) has the molecular formula C25H24FN3O3 and a molecular weight of 433.48 g/mol. Its IUPAC name is N-[1-(3-ethyl-6-methyl-4-oxoquinazolin-2-yl)ethyl]-4-fluoro-N-(furan-2-ylmethyl)benzamide.
| Compound Name | N-[1-(3-ethyl-6-methyl-4-oxoquinazolin-2-yl)ethyl]-4-fluoro-N-(furan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 23763104 |
| Molecular Formula | C25H24FN3O3 |
| Molecular Weight | 433.48 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | N-[1-(3-ethyl-6-methyl-4-oxoquinazolin-2-yl)ethyl]-4-fluoro-N-(furan-2-ylmethyl)benzamide |
| SMILES | CCn1c(C(C)N(Cc2ccco2)C(=O)c2ccc(F)cc2)nc2ccc(C)cc2c1=O |
| InChI | InChI=1S/C25H24FN3O3/c1-4-28-23(27-22-12-7-16(2)14-21(22)25(28)31)17(3)29(15-20-6-5-13-32-20)24(30)18-8-10-19(26)11-9-18/h5-14,17H,4,15H2,1-3H3 |
| InChIKey | ZVBCKFJBBBOSGZ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 68.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.48 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |