C23H27N3O9 — CID 23763126
3-O,5-O-diethyl 4-O-[2-(4-methyl-3-nitroanilino)-2-oxoethyl] 2,6-dimethyl-1,4-dihydropyridine-3,4,5-tricarboxylate (PubChem CID 23763126) has the molecular formula C23H27N3O9 and a molecular weight of 489.48 g/mol. Its IUPAC name is 3-O,5-O-diethyl 4-O-[2-(4-methyl-3-nitroanilino)-2-oxoethyl] 2,6-dimethyl-1,4-dihydropyridine-3,4,5-tricarboxylate.
| Compound Name | 3-O,5-O-diethyl 4-O-[2-(4-methyl-3-nitroanilino)-2-oxoethyl] 2,6-dimethyl-1,4-dihydropyridine-3,4,5-tricarboxylate |
|---|---|
| PubChem CID | 23763126 |
| Molecular Formula | C23H27N3O9 |
| Molecular Weight | 489.48 g/mol |
| Exact Mass | 489.17 |
| IUPAC Name | 3-O,5-O-diethyl 4-O-[2-(4-methyl-3-nitroanilino)-2-oxoethyl] 2,6-dimethyl-1,4-dihydropyridine-3,4,5-tricarboxylate |
| SMILES | CCOC(=O)C1=C(C)NC(C)=C(C(=O)OCC)C1C(=O)OCC(=O)Nc1ccc(C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H27N3O9/c1-6-33-21(28)18-13(4)24-14(5)19(22(29)34-7-2)20(18)23(30)35-11-17(27)25-15-9-8-12(3)16(10-15)26(31)32/h8-10,20,24H,6-7,11H2,1-5H3,(H,25,27) |
| InChIKey | WPNQJDXFCUAUDO-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 163.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.48 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|