C14H20N4O — CID 23763596
6,7,8,9-tetramethyl-2-(propylamino)pyrido[1,2-a][1,3,5]triazin-4-one (PubChem CID 23763596) has the molecular formula C14H20N4O and a molecular weight of 260.34 g/mol. Its IUPAC name is 6,7,8,9-tetramethyl-2-(propylamino)pyrido[1,2-a][1,3,5]triazin-4-one.
| Compound Name | 6,7,8,9-tetramethyl-2-(propylamino)pyrido[1,2-a][1,3,5]triazin-4-one |
|---|---|
| PubChem CID | 23763596 |
| Molecular Formula | C14H20N4O |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | 6,7,8,9-tetramethyl-2-(propylamino)pyrido[1,2-a][1,3,5]triazin-4-one |
| SMILES | CCCNc1nc(=O)n2c(C)c(C)c(C)c(C)c2n1 |
| InChI | InChI=1S/C14H20N4O/c1-6-7-15-13-16-12-10(4)8(2)9(3)11(5)18(12)14(19)17-13/h6-7H2,1-5H3,(H,15,17,19) |
| InChIKey | HWMXBCNCQISWCU-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |