About [(5R)-2,5-dimethyl-1-(2-methylpropyl)-4-phenylpiperidin-4-yl] acetate
[(5R)-2,5-dimethyl-1-(2-methylpropyl)-4-phenylpiperidin-4-yl] acetate (PubChem CID 23765182) has the molecular formula C19H29NO2
and a molecular weight of 303.45 g/mol. Its IUPAC name is [(5R)-2,5-dimethyl-1-(2-methylpropyl)-4-phenylpiperidin-4-yl] acetate.
Molecular Properties
| Compound Name | [(5R)-2,5-dimethyl-1-(2-methylpropyl)-4-phenylpiperidin-4-yl] acetate |
| PubChem CID | 23765182 |
| Molecular Formula | C19H29NO2 |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.22 |
| IUPAC Name | [(5R)-2,5-dimethyl-1-(2-methylpropyl)-4-phenylpiperidin-4-yl] acetate |
| SMILES | CC(=O)OC1(c2ccccc2)CC(C)N(CC(C)C)C[C@H]1C |
| InChI | InChI=1S/C19H29NO2/c1-14(2)12-20-13-15(3)19(11-16(20)4,22-17(5)21)18-9-7-6-8-10-18/h6-10,14-16H,11-13H2,1-5H3/t15-,16?,19?/m1/s1 |
| InChIKey | UXLOMBMHPNHPGX-MDCZIUGASA-N |
| XLogP | 3.83 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(5R)-2,5-dimethyl-1-(2-methylpropyl)-4-phenylpiperidin-4-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(5R)-2,5-dimethyl-1-(2-methylpropyl)-4-phenylpiperidin-4-yl] acetate?
The IUPAC name of [(5R)-2,5-dimethyl-1-(2-methylpropyl)-4-phenylpiperidin-4-yl] acetate (CID 23765182) is [(5R)-2,5-dimethyl-1-(2-methylpropyl)-4-phenylpiperidin-4-yl] acetate.
What is the SMILES notation for [(5R)-2,5-dimethyl-1-(2-methylpropyl)-4-phenylpiperidin-4-yl] acetate?
The canonical SMILES for [(5R)-2,5-dimethyl-1-(2-methylpropyl)-4-phenylpiperidin-4-yl] acetate is CC(=O)OC1(c2ccccc2)CC(C)N(CC(C)C)C[C@H]1C.
What is the InChIKey of [(5R)-2,5-dimethyl-1-(2-methylpropyl)-4-phenylpiperidin-4-yl] acetate?
The InChIKey is UXLOMBMHPNHPGX-MDCZIUGASA-N. The full InChI is InChI=1S/C19H29NO2/c1-14(2)12-20-13-15(3)19(11-16(20)4,22-17(5)21)18-9-7-6-8-10-18/h6-10,14-16H,11-13H2,1-5H3/t15-,16?,19?/m1/s1.
What are the key properties of [(5R)-2,5-dimethyl-1-(2-methylpropyl)-4-phenylpiperidin-4-yl] acetate?
[(5R)-2,5-dimethyl-1-(2-methylpropyl)-4-phenylpiperidin-4-yl] acetate has a molecular weight of 303.45 g/mol, XLogP of 3.83, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(5R)-2,5-dimethyl-1-(2-methylpropyl)-4-phenylpiperidin-4-yl] acetate is sourced from PubChem (CID 23765182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).