C16H16ClN3S — CID 23765773
15-chloro-9-propyl-17-thia-2,12,14-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),9,11(16),12,14-hexaene (PubChem CID 23765773) has the molecular formula C16H16ClN3S and a molecular weight of 317.85 g/mol. Its IUPAC name is 15-chloro-9-propyl-17-thia-2,12,14-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),9,11(16),12,14-hexaene.
| Compound Name | 15-chloro-9-propyl-17-thia-2,12,14-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),9,11(16),12,14-hexaene |
|---|---|
| PubChem CID | 23765773 |
| Molecular Formula | C16H16ClN3S |
| Molecular Weight | 317.85 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | 15-chloro-9-propyl-17-thia-2,12,14-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3(8),9,11(16),12,14-hexaene |
| SMILES | CCCc1c2c(nc3sc4c(Cl)ncnc4c13)CCCC2 |
| InChI | InChI=1S/C16H16ClN3S/c1-2-5-10-9-6-3-4-7-11(9)20-16-12(10)13-14(21-16)15(17)19-8-18-13/h8H,2-7H2,1H3 |
| InChIKey | ASRNJFAMUFFLCF-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.85 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |