C30H33N2O2+ — CID 23766699
4-[1,1-bis(4-methoxyphenyl)but-1-en-2-yl]-3,3-dimethyl-1,2-dihydroimidazo[1,2-a]indol-3-ium (PubChem CID 23766699) has the molecular formula C30H33N2O2+ and a molecular weight of 453.61 g/mol. Its IUPAC name is 4-[1,1-bis(4-methoxyphenyl)but-1-en-2-yl]-3,3-dimethyl-1,2-dihydroimidazo[1,2-a]indol-3-ium.
| Compound Name | 4-[1,1-bis(4-methoxyphenyl)but-1-en-2-yl]-3,3-dimethyl-1,2-dihydroimidazo[1,2-a]indol-3-ium |
|---|---|
| PubChem CID | 23766699 |
| Molecular Formula | C30H33N2O2+ |
| Molecular Weight | 453.61 g/mol |
| Exact Mass | 453.25 |
| IUPAC Name | 4-[1,1-bis(4-methoxyphenyl)but-1-en-2-yl]-3,3-dimethyl-1,2-dihydroimidazo[1,2-a]indol-3-ium |
| SMILES | CCC(=C(c1ccc(OC)cc1)c1ccc(OC)cc1)c1c2n(c3ccccc13)CC[N+]2(C)C |
| InChI | InChI=1S/C30H33N2O2/c1-6-25(29-26-9-7-8-10-27(26)31-19-20-32(2,3)30(29)31)28(21-11-15-23(33-4)16-12-21)22-13-17-24(34-5)18-14-22/h7-18H,6,19-20H2,1-5H3/q+1 |
| InChIKey | BRIPDLNRRLGBON-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 23.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.61 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|