About (2S)-N-(1,3-benzodioxol-5-yl)-2-(carbamoylamino)propanamide
(2S)-N-(1,3-benzodioxol-5-yl)-2-(carbamoylamino)propanamide (PubChem CID 2376691) has the molecular formula C11H13N3O4
and a molecular weight of 251.24 g/mol. Its IUPAC name is (2S)-N-(1,3-benzodioxol-5-yl)-2-(carbamoylamino)propanamide.
Molecular Properties
| Compound Name | (2S)-N-(1,3-benzodioxol-5-yl)-2-(carbamoylamino)propanamide |
| PubChem CID | 2376691 |
| Molecular Formula | C11H13N3O4 |
| Molecular Weight | 251.24 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | (2S)-N-(1,3-benzodioxol-5-yl)-2-(carbamoylamino)propanamide |
| SMILES | C[C@H](NC(N)=O)C(=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C11H13N3O4/c1-6(13-11(12)16)10(15)14-7-2-3-8-9(4-7)18-5-17-8/h2-4,6H,5H2,1H3,(H,14,15)(H3,12,13,16)/t6-/m0/s1 |
| InChIKey | KIGRWDOPPTVSFA-LURJTMIESA-N |
| XLogP | 0.41 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.24 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2S)-N-(1,3-benzodioxol-5-yl)-2-(carbamoylamino)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-N-(1,3-benzodioxol-5-yl)-2-(carbamoylamino)propanamide?
The IUPAC name of (2S)-N-(1,3-benzodioxol-5-yl)-2-(carbamoylamino)propanamide (CID 2376691) is (2S)-N-(1,3-benzodioxol-5-yl)-2-(carbamoylamino)propanamide.
What is the SMILES notation for (2S)-N-(1,3-benzodioxol-5-yl)-2-(carbamoylamino)propanamide?
The canonical SMILES for (2S)-N-(1,3-benzodioxol-5-yl)-2-(carbamoylamino)propanamide is C[C@H](NC(N)=O)C(=O)Nc1ccc2c(c1)OCO2.
What is the InChIKey of (2S)-N-(1,3-benzodioxol-5-yl)-2-(carbamoylamino)propanamide?
The InChIKey is KIGRWDOPPTVSFA-LURJTMIESA-N. The full InChI is InChI=1S/C11H13N3O4/c1-6(13-11(12)16)10(15)14-7-2-3-8-9(4-7)18-5-17-8/h2-4,6H,5H2,1H3,(H,14,15)(H3,12,13,16)/t6-/m0/s1.
What are the key properties of (2S)-N-(1,3-benzodioxol-5-yl)-2-(carbamoylamino)propanamide?
(2S)-N-(1,3-benzodioxol-5-yl)-2-(carbamoylamino)propanamide has a molecular weight of 251.24 g/mol, XLogP of 0.41, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-N-(1,3-benzodioxol-5-yl)-2-(carbamoylamino)propanamide is sourced from PubChem (CID 2376691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).