C15H14Cl3N3 — CID 23766927
4,5-dichloro-2-(4-chlorophenyl)-6-piperidin-1-ylpyrimidine (PubChem CID 23766927) has the molecular formula C15H14Cl3N3 and a molecular weight of 342.66 g/mol. Its IUPAC name is 4,5-dichloro-2-(4-chlorophenyl)-6-piperidin-1-ylpyrimidine.
| Compound Name | 4,5-dichloro-2-(4-chlorophenyl)-6-piperidin-1-ylpyrimidine |
|---|---|
| PubChem CID | 23766927 |
| Molecular Formula | C15H14Cl3N3 |
| Molecular Weight | 342.66 g/mol |
| Exact Mass | 341.03 |
| IUPAC Name | 4,5-dichloro-2-(4-chlorophenyl)-6-piperidin-1-ylpyrimidine |
| SMILES | Clc1ccc(-c2nc(Cl)c(Cl)c(N3CCCCC3)n2)cc1 |
| InChI | InChI=1S/C15H14Cl3N3/c16-11-6-4-10(5-7-11)14-19-13(18)12(17)15(20-14)21-8-2-1-3-9-21/h4-7H,1-3,8-9H2 |
| InChIKey | WLVCNJGBNFHWNU-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.66 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |