C21H15N3O — CID 2376701
(2S)-2-(1H-benzimidazol-2-yl)-4-naphthalen-1-yl-3-oxobutanenitrile (PubChem CID 2376701) has the molecular formula C21H15N3O and a molecular weight of 325.37 g/mol. Its IUPAC name is (2S)-2-(1H-benzimidazol-2-yl)-4-naphthalen-1-yl-3-oxobutanenitrile.
| Compound Name | (2S)-2-(1H-benzimidazol-2-yl)-4-naphthalen-1-yl-3-oxobutanenitrile |
|---|---|
| PubChem CID | 2376701 |
| Molecular Formula | C21H15N3O |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | (2S)-2-(1H-benzimidazol-2-yl)-4-naphthalen-1-yl-3-oxobutanenitrile |
| SMILES | N#C[C@H](C(=O)Cc1cccc2ccccc12)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C21H15N3O/c22-13-17(21-23-18-10-3-4-11-19(18)24-21)20(25)12-15-8-5-7-14-6-1-2-9-16(14)15/h1-11,17H,12H2,(H,23,24)/t17-/m1/s1 |
| InChIKey | GLSDBQUKWXDBSJ-QGZVFWFLSA-N |
| XLogP | 4.14 |
| TPSA | 69.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |