About [2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-2-oxoethyl] 2-fluorobenzoate
[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-2-oxoethyl] 2-fluorobenzoate (PubChem CID 2376810) has the molecular formula C15H9ClF4N2O3
and a molecular weight of 376.69 g/mol. Its IUPAC name is [2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-2-oxoethyl] 2-fluorobenzoate.
Molecular Properties
| Compound Name | [2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-2-oxoethyl] 2-fluorobenzoate |
| PubChem CID | 2376810 |
| Molecular Formula | C15H9ClF4N2O3 |
| Molecular Weight | 376.69 g/mol |
| Exact Mass | 376.02 |
| IUPAC Name | [2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-2-oxoethyl] 2-fluorobenzoate |
| SMILES | O=C(COC(=O)c1ccccc1F)Nc1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C15H9ClF4N2O3/c16-10-5-8(15(18,19)20)6-21-13(10)22-12(23)7-25-14(24)9-3-1-2-4-11(9)17/h1-6H,7H2,(H,21,22,23) |
| InChIKey | JFGCJFVDRRSFHL-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.69 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-2-oxoethyl] 2-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-2-oxoethyl] 2-fluorobenzoate?
The IUPAC name of [2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-2-oxoethyl] 2-fluorobenzoate (CID 2376810) is [2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-2-oxoethyl] 2-fluorobenzoate.
What is the SMILES notation for [2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-2-oxoethyl] 2-fluorobenzoate?
The canonical SMILES for [2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-2-oxoethyl] 2-fluorobenzoate is O=C(COC(=O)c1ccccc1F)Nc1ncc(C(F)(F)F)cc1Cl.
What is the InChIKey of [2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-2-oxoethyl] 2-fluorobenzoate?
The InChIKey is JFGCJFVDRRSFHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H9ClF4N2O3/c16-10-5-8(15(18,19)20)6-21-13(10)22-12(23)7-25-14(24)9-3-1-2-4-11(9)17/h1-6H,7H2,(H,21,22,23).
What are the key properties of [2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-2-oxoethyl] 2-fluorobenzoate?
[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-2-oxoethyl] 2-fluorobenzoate has a molecular weight of 376.69 g/mol, XLogP of 3.69, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]-2-oxoethyl] 2-fluorobenzoate is sourced from PubChem (CID 2376810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).