About N-[2-(2-fluorophenyl)-4-oxoquinazolin-3-yl]-2,3-dimethoxybenzamide
N-[2-(2-fluorophenyl)-4-oxoquinazolin-3-yl]-2,3-dimethoxybenzamide (PubChem CID 23768429) has the molecular formula C23H18FN3O4
and a molecular weight of 419.41 g/mol. Its IUPAC name is N-[2-(2-fluorophenyl)-4-oxoquinazolin-3-yl]-2,3-dimethoxybenzamide.
Molecular Properties
| Compound Name | N-[2-(2-fluorophenyl)-4-oxoquinazolin-3-yl]-2,3-dimethoxybenzamide |
| PubChem CID | 23768429 |
| Molecular Formula | C23H18FN3O4 |
| Molecular Weight | 419.41 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | N-[2-(2-fluorophenyl)-4-oxoquinazolin-3-yl]-2,3-dimethoxybenzamide |
| SMILES | COc1cccc(C(=O)Nn2c(-c3ccccc3F)nc3ccccc3c2=O)c1OC |
| InChI | InChI=1S/C23H18FN3O4/c1-30-19-13-7-10-16(20(19)31-2)22(28)26-27-21(14-8-3-5-11-17(14)24)25-18-12-6-4-9-15(18)23(27)29/h3-13H,1-2H3,(H,26,28) |
| InChIKey | DSSFGOJILREUSD-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 419.41 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[2-(2-fluorophenyl)-4-oxoquinazolin-3-yl]-2,3-dimethoxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(2-fluorophenyl)-4-oxoquinazolin-3-yl]-2,3-dimethoxybenzamide?
The IUPAC name of N-[2-(2-fluorophenyl)-4-oxoquinazolin-3-yl]-2,3-dimethoxybenzamide (CID 23768429) is N-[2-(2-fluorophenyl)-4-oxoquinazolin-3-yl]-2,3-dimethoxybenzamide.
What is the SMILES notation for N-[2-(2-fluorophenyl)-4-oxoquinazolin-3-yl]-2,3-dimethoxybenzamide?
The canonical SMILES for N-[2-(2-fluorophenyl)-4-oxoquinazolin-3-yl]-2,3-dimethoxybenzamide is COc1cccc(C(=O)Nn2c(-c3ccccc3F)nc3ccccc3c2=O)c1OC.
What is the InChIKey of N-[2-(2-fluorophenyl)-4-oxoquinazolin-3-yl]-2,3-dimethoxybenzamide?
The InChIKey is DSSFGOJILREUSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H18FN3O4/c1-30-19-13-7-10-16(20(19)31-2)22(28)26-27-21(14-8-3-5-11-17(14)24)25-18-12-6-4-9-15(18)23(27)29/h3-13H,1-2H3,(H,26,28).
What are the key properties of N-[2-(2-fluorophenyl)-4-oxoquinazolin-3-yl]-2,3-dimethoxybenzamide?
N-[2-(2-fluorophenyl)-4-oxoquinazolin-3-yl]-2,3-dimethoxybenzamide has a molecular weight of 419.41 g/mol, XLogP of 3.60, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(2-fluorophenyl)-4-oxoquinazolin-3-yl]-2,3-dimethoxybenzamide is sourced from PubChem (CID 23768429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).