C23H22FN3O2 — CID 23768618
N-[[4-(aminomethyl)phenyl]methyl]-3-[(3-fluorobenzoyl)amino]-4-methylbenzamide (PubChem CID 23768618) has the molecular formula C23H22FN3O2 and a molecular weight of 391.45 g/mol. Its IUPAC name is N-[[4-(aminomethyl)phenyl]methyl]-3-[(3-fluorobenzoyl)amino]-4-methylbenzamide.
| Compound Name | N-[[4-(aminomethyl)phenyl]methyl]-3-[(3-fluorobenzoyl)amino]-4-methylbenzamide |
|---|---|
| PubChem CID | 23768618 |
| Molecular Formula | C23H22FN3O2 |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | N-[[4-(aminomethyl)phenyl]methyl]-3-[(3-fluorobenzoyl)amino]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NCc2ccc(CN)cc2)cc1NC(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C23H22FN3O2/c1-15-5-10-19(22(28)26-14-17-8-6-16(13-25)7-9-17)12-21(15)27-23(29)18-3-2-4-20(24)11-18/h2-12H,13-14,25H2,1H3,(H,26,28)(H,27,29) |
| InChIKey | XMJSMNCIAGHKTI-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |