About [2-oxo-2-(3-phenylpropylamino)ethyl] 3,4-dimethoxybenzoate
[2-oxo-2-(3-phenylpropylamino)ethyl] 3,4-dimethoxybenzoate (PubChem CID 2376888) has the molecular formula C20H23NO5
and a molecular weight of 357.41 g/mol. Its IUPAC name is [2-oxo-2-(3-phenylpropylamino)ethyl] 3,4-dimethoxybenzoate.
Molecular Properties
| Compound Name | [2-oxo-2-(3-phenylpropylamino)ethyl] 3,4-dimethoxybenzoate |
| PubChem CID | 2376888 |
| Molecular Formula | C20H23NO5 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | [2-oxo-2-(3-phenylpropylamino)ethyl] 3,4-dimethoxybenzoate |
| SMILES | COc1ccc(C(=O)OCC(=O)NCCCc2ccccc2)cc1OC |
| InChI | InChI=1S/C20H23NO5/c1-24-17-11-10-16(13-18(17)25-2)20(23)26-14-19(22)21-12-6-9-15-7-4-3-5-8-15/h3-5,7-8,10-11,13H,6,9,12,14H2,1-2H3,(H,21,22) |
| InChIKey | MXVMLAFEWDJARE-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [2-oxo-2-(3-phenylpropylamino)ethyl] 3,4-dimethoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-oxo-2-(3-phenylpropylamino)ethyl] 3,4-dimethoxybenzoate?
The IUPAC name of [2-oxo-2-(3-phenylpropylamino)ethyl] 3,4-dimethoxybenzoate (CID 2376888) is [2-oxo-2-(3-phenylpropylamino)ethyl] 3,4-dimethoxybenzoate.
What is the SMILES notation for [2-oxo-2-(3-phenylpropylamino)ethyl] 3,4-dimethoxybenzoate?
The canonical SMILES for [2-oxo-2-(3-phenylpropylamino)ethyl] 3,4-dimethoxybenzoate is COc1ccc(C(=O)OCC(=O)NCCCc2ccccc2)cc1OC.
What is the InChIKey of [2-oxo-2-(3-phenylpropylamino)ethyl] 3,4-dimethoxybenzoate?
The InChIKey is MXVMLAFEWDJARE-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23NO5/c1-24-17-11-10-16(13-18(17)25-2)20(23)26-14-19(22)21-12-6-9-15-7-4-3-5-8-15/h3-5,7-8,10-11,13H,6,9,12,14H2,1-2H3,(H,21,22).
What are the key properties of [2-oxo-2-(3-phenylpropylamino)ethyl] 3,4-dimethoxybenzoate?
[2-oxo-2-(3-phenylpropylamino)ethyl] 3,4-dimethoxybenzoate has a molecular weight of 357.41 g/mol, XLogP of 2.61, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-oxo-2-(3-phenylpropylamino)ethyl] 3,4-dimethoxybenzoate is sourced from PubChem (CID 2376888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).