About [2-(2-adamantylamino)-2-oxoethyl] 2-ethoxyacetate
[2-(2-adamantylamino)-2-oxoethyl] 2-ethoxyacetate (PubChem CID 2377056) has the molecular formula C16H25NO4
and a molecular weight of 295.38 g/mol. Its IUPAC name is [2-(2-adamantylamino)-2-oxoethyl] 2-ethoxyacetate.
Molecular Properties
| Compound Name | [2-(2-adamantylamino)-2-oxoethyl] 2-ethoxyacetate |
| PubChem CID | 2377056 |
| Molecular Formula | C16H25NO4 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | [2-(2-adamantylamino)-2-oxoethyl] 2-ethoxyacetate |
| SMILES | CCOCC(=O)OCC(=O)NC1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C16H25NO4/c1-2-20-9-15(19)21-8-14(18)17-16-12-4-10-3-11(6-12)7-13(16)5-10/h10-13,16H,2-9H2,1H3,(H,17,18) |
| InChIKey | PQCFVQXQBAUGGH-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(2-adamantylamino)-2-oxoethyl] 2-ethoxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2-adamantylamino)-2-oxoethyl] 2-ethoxyacetate?
The IUPAC name of [2-(2-adamantylamino)-2-oxoethyl] 2-ethoxyacetate (CID 2377056) is [2-(2-adamantylamino)-2-oxoethyl] 2-ethoxyacetate.
What is the SMILES notation for [2-(2-adamantylamino)-2-oxoethyl] 2-ethoxyacetate?
The canonical SMILES for [2-(2-adamantylamino)-2-oxoethyl] 2-ethoxyacetate is CCOCC(=O)OCC(=O)NC1C2CC3CC(C2)CC1C3.
What is the InChIKey of [2-(2-adamantylamino)-2-oxoethyl] 2-ethoxyacetate?
The InChIKey is PQCFVQXQBAUGGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25NO4/c1-2-20-9-15(19)21-8-14(18)17-16-12-4-10-3-11(6-12)7-13(16)5-10/h10-13,16H,2-9H2,1H3,(H,17,18).
What are the key properties of [2-(2-adamantylamino)-2-oxoethyl] 2-ethoxyacetate?
[2-(2-adamantylamino)-2-oxoethyl] 2-ethoxyacetate has a molecular weight of 295.38 g/mol, XLogP of 1.51, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2-adamantylamino)-2-oxoethyl] 2-ethoxyacetate is sourced from PubChem (CID 2377056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).