C19H15N3O4S — CID 23771057
3-[5-(2,4-dimethoxyanilino)-1,3,4-thiadiazol-2-yl]chromen-2-one (PubChem CID 23771057) has the molecular formula C19H15N3O4S and a molecular weight of 381.41 g/mol. Its IUPAC name is 3-[5-(2,4-dimethoxyanilino)-1,3,4-thiadiazol-2-yl]chromen-2-one.
| Compound Name | 3-[5-(2,4-dimethoxyanilino)-1,3,4-thiadiazol-2-yl]chromen-2-one |
|---|---|
| PubChem CID | 23771057 |
| Molecular Formula | C19H15N3O4S |
| Molecular Weight | 381.41 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | 3-[5-(2,4-dimethoxyanilino)-1,3,4-thiadiazol-2-yl]chromen-2-one |
| SMILES | COc1ccc(Nc2nnc(-c3cc4ccccc4oc3=O)s2)c(OC)c1 |
| InChI | InChI=1S/C19H15N3O4S/c1-24-12-7-8-14(16(10-12)25-2)20-19-22-21-17(27-19)13-9-11-5-3-4-6-15(11)26-18(13)23/h3-10H,1-2H3,(H,20,22) |
| InChIKey | OFHVZHPTWFUMNJ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 86.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.41 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|