C12H13N5O2 — CID 23771252
3-benzamido-N,N-dimethyl-1H-1,2,4-triazole-5-carboxamide (PubChem CID 23771252) has the molecular formula C12H13N5O2 and a molecular weight of 259.27 g/mol. Its IUPAC name is 3-benzamido-N,N-dimethyl-1H-1,2,4-triazole-5-carboxamide.
| Compound Name | 3-benzamido-N,N-dimethyl-1H-1,2,4-triazole-5-carboxamide |
|---|---|
| PubChem CID | 23771252 |
| Molecular Formula | C12H13N5O2 |
| Molecular Weight | 259.27 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | 3-benzamido-N,N-dimethyl-1H-1,2,4-triazole-5-carboxamide |
| SMILES | CN(C)C(=O)c1nc(NC(=O)c2ccccc2)n[nH]1 |
| InChI | InChI=1S/C12H13N5O2/c1-17(2)11(19)9-13-12(16-15-9)14-10(18)8-6-4-3-5-7-8/h3-7H,1-2H3,(H2,13,14,15,16,18) |
| InChIKey | NAGKSCBOUGPXGK-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.27 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |