About 3-methyl-1-phenyl-7,8-dihydro-6H-pyrazolo[3,4-b]quinolin-5-one
3-methyl-1-phenyl-7,8-dihydro-6H-pyrazolo[3,4-b]quinolin-5-one (PubChem CID 2377208) has the molecular formula C17H15N3O
and a molecular weight of 277.33 g/mol. Its IUPAC name is 3-methyl-1-phenyl-7,8-dihydro-6H-pyrazolo[3,4-b]quinolin-5-one.
Molecular Properties
| Compound Name | 3-methyl-1-phenyl-7,8-dihydro-6H-pyrazolo[3,4-b]quinolin-5-one |
| PubChem CID | 2377208 |
| Molecular Formula | C17H15N3O |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | 3-methyl-1-phenyl-7,8-dihydro-6H-pyrazolo[3,4-b]quinolin-5-one |
| SMILES | Cc1nn(-c2ccccc2)c2nc3c(cc12)C(=O)CCC3 |
| InChI | InChI=1S/C17H15N3O/c1-11-13-10-14-15(8-5-9-16(14)21)18-17(13)20(19-11)12-6-3-2-4-7-12/h2-4,6-7,10H,5,8-9H2,1H3 |
| InChIKey | LVCOFZHJBKEZFR-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-methyl-1-phenyl-7,8-dihydro-6H-pyrazolo[3,4-b]quinolin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-1-phenyl-7,8-dihydro-6H-pyrazolo[3,4-b]quinolin-5-one?
The IUPAC name of 3-methyl-1-phenyl-7,8-dihydro-6H-pyrazolo[3,4-b]quinolin-5-one (CID 2377208) is 3-methyl-1-phenyl-7,8-dihydro-6H-pyrazolo[3,4-b]quinolin-5-one.
What is the SMILES notation for 3-methyl-1-phenyl-7,8-dihydro-6H-pyrazolo[3,4-b]quinolin-5-one?
The canonical SMILES for 3-methyl-1-phenyl-7,8-dihydro-6H-pyrazolo[3,4-b]quinolin-5-one is Cc1nn(-c2ccccc2)c2nc3c(cc12)C(=O)CCC3.
What is the InChIKey of 3-methyl-1-phenyl-7,8-dihydro-6H-pyrazolo[3,4-b]quinolin-5-one?
The InChIKey is LVCOFZHJBKEZFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15N3O/c1-11-13-10-14-15(8-5-9-16(14)21)18-17(13)20(19-11)12-6-3-2-4-7-12/h2-4,6-7,10H,5,8-9H2,1H3.
What are the key properties of 3-methyl-1-phenyl-7,8-dihydro-6H-pyrazolo[3,4-b]quinolin-5-one?
3-methyl-1-phenyl-7,8-dihydro-6H-pyrazolo[3,4-b]quinolin-5-one has a molecular weight of 277.33 g/mol, XLogP of 3.25, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-1-phenyl-7,8-dihydro-6H-pyrazolo[3,4-b]quinolin-5-one is sourced from PubChem (CID 2377208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).