C32H33NO5 — CID 23773223
1-(3,5-dimethoxyphenyl)-7,7-dimethyl-4-(4-phenylmethoxyphenyl)-3,4,6,8-tetrahydroquinoline-2,5-dione (PubChem CID 23773223) has the molecular formula C32H33NO5 and a molecular weight of 511.62 g/mol. Its IUPAC name is 1-(3,5-dimethoxyphenyl)-7,7-dimethyl-4-(4-phenylmethoxyphenyl)-3,4,6,8-tetrahydroquinoline-2,5-dione.
| Compound Name | 1-(3,5-dimethoxyphenyl)-7,7-dimethyl-4-(4-phenylmethoxyphenyl)-3,4,6,8-tetrahydroquinoline-2,5-dione |
|---|---|
| PubChem CID | 23773223 |
| Molecular Formula | C32H33NO5 |
| Molecular Weight | 511.62 g/mol |
| Exact Mass | 511.24 |
| IUPAC Name | 1-(3,5-dimethoxyphenyl)-7,7-dimethyl-4-(4-phenylmethoxyphenyl)-3,4,6,8-tetrahydroquinoline-2,5-dione |
| SMILES | COc1cc(OC)cc(N2C(=O)CC(c3ccc(OCc4ccccc4)cc3)C3=C2CC(C)(C)CC3=O)c1 |
| InChI | InChI=1S/C32H33NO5/c1-32(2)18-28-31(29(34)19-32)27(17-30(35)33(28)23-14-25(36-3)16-26(15-23)37-4)22-10-12-24(13-11-22)38-20-21-8-6-5-7-9-21/h5-16,27H,17-20H2,1-4H3 |
| InChIKey | VIXIWCFMVYTCDI-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.62 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |