C23H16N2O4S — CID 23773584
(3-oxo-3-phenothiazin-10-ylpropyl) 1,3-benzoxazole-4-carboxylate (PubChem CID 23773584) has the molecular formula C23H16N2O4S and a molecular weight of 416.46 g/mol. Its IUPAC name is (3-oxo-3-phenothiazin-10-ylpropyl) 1,3-benzoxazole-4-carboxylate.
| Compound Name | (3-oxo-3-phenothiazin-10-ylpropyl) 1,3-benzoxazole-4-carboxylate |
|---|---|
| PubChem CID | 23773584 |
| Molecular Formula | C23H16N2O4S |
| Molecular Weight | 416.46 g/mol |
| Exact Mass | 416.08 |
| IUPAC Name | (3-oxo-3-phenothiazin-10-ylpropyl) 1,3-benzoxazole-4-carboxylate |
| SMILES | O=C(OCCC(=O)N1c2ccccc2Sc2ccccc21)c1cccc2ocnc12 |
| InChI | InChI=1S/C23H16N2O4S/c26-21(12-13-28-23(27)15-6-5-9-18-22(15)24-14-29-18)25-16-7-1-3-10-19(16)30-20-11-4-2-8-17(20)25/h1-11,14H,12-13H2 |
| InChIKey | MWMNANQPZDFQEP-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 72.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.46 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |