C21H19BrN2O2 — CID 23775445
4-(3-bromo-4-prop-2-enoxyphenyl)-3,4,5,6-tetrahydro-1H-benzo[h]quinazolin-2-one (PubChem CID 23775445) has the molecular formula C21H19BrN2O2 and a molecular weight of 411.30 g/mol. Its IUPAC name is 4-(3-bromo-4-prop-2-enoxyphenyl)-3,4,5,6-tetrahydro-1H-benzo[h]quinazolin-2-one.
| Compound Name | 4-(3-bromo-4-prop-2-enoxyphenyl)-3,4,5,6-tetrahydro-1H-benzo[h]quinazolin-2-one |
|---|---|
| PubChem CID | 23775445 |
| Molecular Formula | C21H19BrN2O2 |
| Molecular Weight | 411.30 g/mol |
| Exact Mass | 410.06 |
| IUPAC Name | 4-(3-bromo-4-prop-2-enoxyphenyl)-3,4,5,6-tetrahydro-1H-benzo[h]quinazolin-2-one |
| SMILES | C=CCOc1ccc(C2NC(=O)NC3=C2CCc2ccccc23)cc1Br |
| InChI | InChI=1S/C21H19BrN2O2/c1-2-11-26-18-10-8-14(12-17(18)22)19-16-9-7-13-5-3-4-6-15(13)20(16)24-21(25)23-19/h2-6,8,10,12,19H,1,7,9,11H2,(H2,23,24,25) |
| InChIKey | OYBKWBNZGQYSAO-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.30 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|